C10H16N2O — CID 165101826
2,5-dipropyl-1H-pyrimidin-6-one (PubChem CID 165101826) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,5-dipropyl-1H-pyrimidin-6-one.
| Compound Name | 2,5-dipropyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 165101826 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2,5-dipropyl-1H-pyrimidin-6-one |
| SMILES | CCCc1ncc(CCC)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N2O/c1-3-5-8-7-11-9(6-4-2)12-10(8)13/h7H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | YLPJIOYAAAJBSY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |