C40H78O12 — CID 165102887
bis(tert-butyl 2-ethyl-5,5-dimethoxy-4-methylpentanoate);2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid (PubChem CID 165102887) has the molecular formula C40H78O12 and a molecular weight of 751.05 g/mol. Its IUPAC name is bis(tert-butyl 2-ethyl-5,5-dimethoxy-4-methylpentanoate);2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid.
| Compound Name | bis(tert-butyl 2-ethyl-5,5-dimethoxy-4-methylpentanoate);2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid |
|---|---|
| PubChem CID | 165102887 |
| Molecular Formula | C40H78O12 |
| Molecular Weight | 751.05 g/mol |
| Exact Mass | 750.55 |
| IUPAC Name | bis(tert-butyl 2-ethyl-5,5-dimethoxy-4-methylpentanoate);2-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid |
| SMILES | CCC(CC(C)C(=O)O)C(=O)OC(C)(C)C.CCC(CC(C)C(OC)OC)C(=O)OC(C)(C)C.CCC(CC(C)C(OC)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/2C14H28O4.C12H22O4/c2*1-8-11(12(15)18-14(3,4)5)9-10(2)13(16-6)17-7;1-6-9(7-8(2)10(13)14)11(15)16-12(3,4)5/h2*10-11,13H,8-9H2,1-7H3;8-9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | YQCIQNPKVKRNFK-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.05 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|