C15H25N3S — CID 165104302
5-tert-butyl-1-methylpyrazole;5-tert-butyl-1,3-thiazole (PubChem CID 165104302) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 5-tert-butyl-1-methylpyrazole;5-tert-butyl-1,3-thiazole.
| Compound Name | 5-tert-butyl-1-methylpyrazole;5-tert-butyl-1,3-thiazole |
|---|---|
| PubChem CID | 165104302 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 5-tert-butyl-1-methylpyrazole;5-tert-butyl-1,3-thiazole |
| SMILES | CC(C)(C)c1cncs1.Cn1nccc1C(C)(C)C |
| InChI | InChI=1S/C8H14N2.C7H11NS/c1-8(2,3)7-5-6-9-10(7)4;1-7(2,3)6-4-8-5-9-6/h5-6H,1-4H3;4-5H,1-3H3 |
| InChIKey | YWHUQJJRWXUGHB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |