C12H20IN3O — CID 165104498
5-cyclopropyl-3-(4-methylpiperidin-4-yl)-1,2,4-oxadiazole;iodomethane (PubChem CID 165104498) has the molecular formula C12H20IN3O and a molecular weight of 349.22 g/mol. Its IUPAC name is 5-cyclopropyl-3-(4-methylpiperidin-4-yl)-1,2,4-oxadiazole;iodomethane.
| Compound Name | 5-cyclopropyl-3-(4-methylpiperidin-4-yl)-1,2,4-oxadiazole;iodomethane |
|---|---|
| PubChem CID | 165104498 |
| Molecular Formula | C12H20IN3O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-cyclopropyl-3-(4-methylpiperidin-4-yl)-1,2,4-oxadiazole;iodomethane |
| SMILES | CC1(c2noc(C3CC3)n2)CCNCC1.CI |
| InChI | InChI=1S/C11H17N3O.CH3I/c1-11(4-6-12-7-5-11)10-13-9(15-14-10)8-2-3-8;1-2/h8,12H,2-7H2,1H3;1H3 |
| InChIKey | YXAFEOZZHLMCGW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|