About cyclohexa-1,5-diene-1,2,4-triamine
cyclohexa-1,5-diene-1,2,4-triamine (PubChem CID 165106631) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is cyclohexa-1,5-diene-1,2,4-triamine.
Molecular Properties
| Compound Name | cyclohexa-1,5-diene-1,2,4-triamine |
| PubChem CID | 165106631 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | cyclohexa-1,5-diene-1,2,4-triamine |
| SMILES | NC1=C(N)CC(N)C=C1 |
| InChI | InChI=1S/C6H11N3/c7-4-1-2-5(8)6(9)3-4/h1-2,4H,3,7-9H2 |
| InChIKey | ZGAOYZLFRFVZKF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexa-1,5-diene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-diene-1,2,4-triamine?
The IUPAC name of cyclohexa-1,5-diene-1,2,4-triamine (CID 165106631) is cyclohexa-1,5-diene-1,2,4-triamine.
What is the SMILES notation for cyclohexa-1,5-diene-1,2,4-triamine?
The canonical SMILES for cyclohexa-1,5-diene-1,2,4-triamine is NC1=C(N)CC(N)C=C1.
What is the InChIKey of cyclohexa-1,5-diene-1,2,4-triamine?
The InChIKey is ZGAOYZLFRFVZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c7-4-1-2-5(8)6(9)3-4/h1-2,4H,3,7-9H2.
What are the key properties of cyclohexa-1,5-diene-1,2,4-triamine?
cyclohexa-1,5-diene-1,2,4-triamine has a molecular weight of 125.17 g/mol, XLogP of -0.60, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-diene-1,2,4-triamine is sourced from PubChem (CID 165106631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).