C24H20FNO — CID 165107494
3-[3-(4-fluorophenyl)-2-(3-methylbut-3-enyl)-1-benzofuran-6-yl]pyridine (PubChem CID 165107494) has the molecular formula C24H20FNO and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-2-(3-methylbut-3-enyl)-1-benzofuran-6-yl]pyridine.
| Compound Name | 3-[3-(4-fluorophenyl)-2-(3-methylbut-3-enyl)-1-benzofuran-6-yl]pyridine |
|---|---|
| PubChem CID | 165107494 |
| Molecular Formula | C24H20FNO |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-2-(3-methylbut-3-enyl)-1-benzofuran-6-yl]pyridine |
| SMILES | C=C(C)CCc1oc2cc(-c3cccnc3)ccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FNO/c1-16(2)5-12-22-24(17-6-9-20(25)10-7-17)21-11-8-18(14-23(21)27-22)19-4-3-13-26-15-19/h3-4,6-11,13-15H,1,5,12H2,2H3 |
| InChIKey | QRHLMHVVKVNDJW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|