C28H29N3O5 — CID 16510792
[2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16510792) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16510792 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-3,5-dimethylanilino]-2-oxoethyl] 2-cyclohexyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(C)cc(N(CCC#N)C(=O)COC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c1 |
| InChI | InChI=1S/C28H29N3O5/c1-18-13-19(2)15-22(14-18)30(12-6-11-29)25(32)17-36-28(35)20-9-10-23-24(16-20)27(34)31(26(23)33)21-7-4-3-5-8-21/h9-10,13-16,21H,3-8,12,17H2,1-2H3 |
| InChIKey | BSALGMYYZUQINU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|