C21H19FN2O2 — CID 165108492
12,12-dideuterio-2-[4-(2-deuteriopyrrolidin-2-yl)-3-fluorophenyl]-11-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 165108492) has the molecular formula C21H19FN2O2 and a molecular weight of 353.41 g/mol. Its IUPAC name is 12,12-dideuterio-2-[4-(2-deuteriopyrrolidin-2-yl)-3-fluorophenyl]-11-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 12,12-dideuterio-2-[4-(2-deuteriopyrrolidin-2-yl)-3-fluorophenyl]-11-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 165108492 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 12,12-dideuterio-2-[4-(2-deuteriopyrrolidin-2-yl)-3-fluorophenyl]-11-oxa-3-azatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | [2H]C1(c2ccc(-c3[nH]c4cccc5c4c3C([2H])([2H])OCC5=O)cc2F)CCCN1 |
| InChI | InChI=1S/C21H19FN2O2/c22-16-9-12(6-7-13(16)17-5-2-8-23-17)21-15-10-26-11-19(25)14-3-1-4-18(24-21)20(14)15/h1,3-4,6-7,9,17,23-24H,2,5,8,10-11H2/i10D2,17D |
| InChIKey | HDXPXKUDWWISDE-HTTWDFOLSA-N |
| XLogP | 4.11 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |