C12H18I2O2SV — CID 165111408
(1R,4aR,8aR)-8a-hydroxy-1,4a-dimethyl-3,4,5,6-tetrahydro-1H-naphthalen-2-one;(diiodo-λ4-sulfanylidene)vanadium (PubChem CID 165111408) has the molecular formula C12H18I2O2SV and a molecular weight of 531.09 g/mol. Its IUPAC name is (1R,4aR,8aR)-8a-hydroxy-1,4a-dimethyl-3,4,5,6-tetrahydro-1H-naphthalen-2-one;(diiodo-λ4-sulfanylidene)vanadium.
| Compound Name | (1R,4aR,8aR)-8a-hydroxy-1,4a-dimethyl-3,4,5,6-tetrahydro-1H-naphthalen-2-one;(diiodo-λ4-sulfanylidene)vanadium |
|---|---|
| PubChem CID | 165111408 |
| Molecular Formula | C12H18I2O2SV |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.86 |
| IUPAC Name | (1R,4aR,8aR)-8a-hydroxy-1,4a-dimethyl-3,4,5,6-tetrahydro-1H-naphthalen-2-one;(diiodo-λ4-sulfanylidene)vanadium |
| SMILES | C[C@H]1C(=O)CC[C@@]2(C)CCC=C[C@@]12O.[V]=S(I)I |
| InChI | InChI=1S/C12H18O2.I2S.V/c1-9-10(13)5-8-11(2)6-3-4-7-12(9,11)14;1-3-2;/h4,7,9,14H,3,5-6,8H2,1-2H3;;/t9-,11+,12+;;/m0../s1 |
| InChIKey | ZZZNHRFCRCWNHD-TYNZAHGASA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|