C16H24N2O3 — CID 165111874
tert-butyl 4-(4-amino-2,3,5,6-tetradeuteriophenoxy)piperidine-1-carboxylate (PubChem CID 165111874) has the molecular formula C16H24N2O3 and a molecular weight of 296.40 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-2,3,5,6-tetradeuteriophenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-2,3,5,6-tetradeuteriophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 165111874 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | tert-butyl 4-(4-amino-2,3,5,6-tetradeuteriophenoxy)piperidine-1-carboxylate |
| SMILES | [2H]c1c([2H])c(OC2CCN(C(=O)OC(C)(C)C)CC2)c([2H])c([2H])c1N |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)21-15(19)18-10-8-14(9-11-18)20-13-6-4-12(17)5-7-13/h4-7,14H,8-11,17H2,1-3H3/i4D,5D,6D,7D |
| InChIKey | WEIBGUDKHYWNMW-UGWFXTGHSA-N |
| XLogP | 3.05 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|