C36H32N4O2S — CID 165111896
6-[3-(1,3-benzothiazol-2-yl)-1-prop-2-enylindol-5-yl]-2-[2-(diethylamino)ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 165111896) has the molecular formula C36H32N4O2S and a molecular weight of 584.75 g/mol. Its IUPAC name is 6-[3-(1,3-benzothiazol-2-yl)-1-prop-2-enylindol-5-yl]-2-[2-(diethylamino)ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[3-(1,3-benzothiazol-2-yl)-1-prop-2-enylindol-5-yl]-2-[2-(diethylamino)ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 165111896 |
| Molecular Formula | C36H32N4O2S |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 6-[3-(1,3-benzothiazol-2-yl)-1-prop-2-enylindol-5-yl]-2-[2-(diethylamino)ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | C=CCn1cc(-c2nc3ccccc3s2)c2cc(-c3ccc4c5c(cccc35)C(=O)N(CCN(CC)CC)C4=O)ccc21 |
| InChI | InChI=1S/C36H32N4O2S/c1-4-18-39-22-29(34-37-30-12-7-8-13-32(30)43-34)28-21-23(14-17-31(28)39)24-15-16-27-33-25(24)10-9-11-26(33)35(41)40(36(27)42)20-19-38(5-2)6-3/h4,7-17,21-22H,1,5-6,18-20H2,2-3H3 |
| InChIKey | SSGLEOUIGMZZRW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|