About 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid
5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid (PubChem CID 165111908) has the molecular formula C15H12N2O7S
and a molecular weight of 364.34 g/mol. Its IUPAC name is 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid |
| PubChem CID | 165111908 |
| Molecular Formula | C15H12N2O7S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid |
| SMILES | CC(=O)Oc1csc(N(C(C)=O)c2cc(C(=O)O)cc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C15H12N2O7S/c1-7(18)17(15-16-12(6-25-15)24-8(2)19)11-4-9(13(20)21)3-10(5-11)14(22)23/h3-6H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | ZWNYVORRKWLXNJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid (CID 165111908) is 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid is CC(=O)Oc1csc(N(C(C)=O)c2cc(C(=O)O)cc(C(=O)O)c2)n1.
What is the InChIKey of 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid?
The InChIKey is ZWNYVORRKWLXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O7S/c1-7(18)17(15-16-12(6-25-15)24-8(2)19)11-4-9(13(20)21)3-10(5-11)14(22)23/h3-6H,1-2H3,(H,20,21)(H,22,23).
What are the key properties of 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid?
5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid has a molecular weight of 364.34 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[acetyl-(4-acetyloxy-1,3-thiazol-2-yl)amino]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 165111908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).