C25H39N3O5S — CID 165112030
(14R,16S,17R)-16-(dimethylsulfamoylamino)-14-methyl-12-oxo-7,19-dioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene (PubChem CID 165112030) has the molecular formula C25H39N3O5S and a molecular weight of 493.67 g/mol. Its IUPAC name is (14R,16S,17R)-16-(dimethylsulfamoylamino)-14-methyl-12-oxo-7,19-dioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene.
| Compound Name | (14R,16S,17R)-16-(dimethylsulfamoylamino)-14-methyl-12-oxo-7,19-dioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene |
|---|---|
| PubChem CID | 165112030 |
| Molecular Formula | C25H39N3O5S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (14R,16S,17R)-16-(dimethylsulfamoylamino)-14-methyl-12-oxo-7,19-dioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2(25),3,5-triene |
| SMILES | C[C@@H]1C[C@H](NS(=O)(=O)N(C)C)[C@@H]2COC3CCC(CC3)c3cccc(c3)OCCCCC(=O)N12 |
| InChI | InChI=1S/C25H39N3O5S/c1-18-15-23(26-34(30,31)27(2)3)24-17-33-21-12-10-19(11-13-21)20-7-6-8-22(16-20)32-14-5-4-9-25(29)28(18)24/h6-8,16,18-19,21,23-24,26H,4-5,9-15,17H2,1-3H3/t18-,19?,21?,23+,24+/m1/s1 |
| InChIKey | PICQPPPTXOGRBD-YDAFSYGQSA-N |
| XLogP | 3.05 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |