C24H37N3O5S — CID 165112034
(13R,15S,16R)-15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene (PubChem CID 165112034) has the molecular formula C24H37N3O5S and a molecular weight of 479.64 g/mol. Its IUPAC name is (13R,15S,16R)-15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene.
| Compound Name | (13R,15S,16R)-15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene |
|---|---|
| PubChem CID | 165112034 |
| Molecular Formula | C24H37N3O5S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (13R,15S,16R)-15-(dimethylsulfamoylamino)-13-methyl-11-oxo-7,18-dioxa-12-azatetracyclo[17.2.2.12,6.012,16]tetracosa-2(24),3,5-triene |
| SMILES | C[C@@H]1C[C@H](NS(=O)(=O)N(C)C)[C@@H]2COC3CCC(CC3)c3cccc(c3)OCCCC(=O)N12 |
| InChI | InChI=1S/C24H37N3O5S/c1-17-14-22(25-33(29,30)26(2)3)23-16-32-20-11-9-18(10-12-20)19-6-4-7-21(15-19)31-13-5-8-24(28)27(17)23/h4,6-7,15,17-18,20,22-23,25H,5,8-14,16H2,1-3H3/t17-,18?,20?,22+,23+/m1/s1 |
| InChIKey | MPUPMAMATIQRHH-DPILDVQXSA-N |
| XLogP | 2.66 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |