C24H33F3N2O6S — CID 165112059
N-[(14R,16S,17R)-14-methyl-12-oxo-4-(trifluoromethyl)-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-16-yl]methanesulfonamide (PubChem CID 165112059) has the molecular formula C24H33F3N2O6S and a molecular weight of 534.60 g/mol. Its IUPAC name is N-[(14R,16S,17R)-14-methyl-12-oxo-4-(trifluoromethyl)-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-16-yl]methanesulfonamide.
| Compound Name | N-[(14R,16S,17R)-14-methyl-12-oxo-4-(trifluoromethyl)-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-16-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165112059 |
| Molecular Formula | C24H33F3N2O6S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | N-[(14R,16S,17R)-14-methyl-12-oxo-4-(trifluoromethyl)-7,11,19-trioxa-13-azatetracyclo[18.2.2.12,6.013,17]pentacosa-2,4,6(25)-trien-16-yl]methanesulfonamide |
| SMILES | C[C@@H]1C[C@H](NS(C)(=O)=O)[C@@H]2COC3CCC(CC3)c3cc(cc(C(F)(F)F)c3)OCCCOC(=O)N12 |
| InChI | InChI=1S/C24H33F3N2O6S/c1-15-10-21(28-36(2,31)32)22-14-35-19-6-4-16(5-7-19)17-11-18(24(25,26)27)13-20(12-17)33-8-3-9-34-23(30)29(15)22/h11-13,15-16,19,21-22,28H,3-10,14H2,1-2H3/t15-,16?,19?,21+,22+/m1/s1 |
| InChIKey | IMCWVEBYRDICFN-LTTJIRAPSA-N |
| XLogP | 4.05 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |