C25H30ClFN4O5 — CID 165112134
3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 165112134) has the molecular formula C25H30ClFN4O5 and a molecular weight of 520.99 g/mol. Its IUPAC name is 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 165112134 |
| Molecular Formula | C25H30ClFN4O5 |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | CCNC(=O)C(=O)C(C[C@@H]1CCNC1=O)NC(=O)[C@H](CC1CC1)NC(=O)/C=C/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C25H30ClFN4O5/c1-2-28-25(36)22(33)19(12-16-9-10-29-23(16)34)31-24(35)20(11-14-3-4-14)30-21(32)8-6-15-5-7-17(26)13-18(15)27/h5-8,13-14,16,19-20H,2-4,9-12H2,1H3,(H,28,36)(H,29,34)(H,30,32)(H,31,35)/b8-6+/t16-,19?,20-/m0/s1 |
| InChIKey | LIBCEPMYUKLXOO-TVNVWHCESA-N |
| XLogP | 1.49 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|