C26H30ClFN4O5 — CID 165112135
3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-cyclopropyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 165112135) has the molecular formula C26H30ClFN4O5 and a molecular weight of 533.00 g/mol. Its IUPAC name is 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-cyclopropyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-cyclopropyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 165112135 |
| Molecular Formula | C26H30ClFN4O5 |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-cyclopropyl-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1F)N[C@@H](CC1CC1)C(=O)NC(C[C@@H]1CCNC1=O)C(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C26H30ClFN4O5/c27-17-5-3-15(19(28)13-17)4-8-22(33)31-21(11-14-1-2-14)25(36)32-20(12-16-9-10-29-24(16)35)23(34)26(37)30-18-6-7-18/h3-5,8,13-14,16,18,20-21H,1-2,6-7,9-12H2,(H,29,35)(H,30,37)(H,31,33)(H,32,36)/b8-4+/t16-,20?,21-/m0/s1 |
| InChIKey | SQPSZFRJMACOHI-FITVQIMDSA-N |
| XLogP | 1.64 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|