C24H32ClN5OS — CID 165112157
N-[5-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]pentyl]-5-methylimidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 165112157) has the molecular formula C24H32ClN5OS and a molecular weight of 474.07 g/mol. Its IUPAC name is N-[5-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]pentyl]-5-methylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-[5-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]pentyl]-5-methylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 165112157 |
| Molecular Formula | C24H32ClN5OS |
| Molecular Weight | 474.07 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[5-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]pentyl]-5-methylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | CCc1cccc(N2CCN(CCCCCNC(=O)c3nc4sccn4c3C)CC2)c1Cl |
| InChI | InChI=1S/C24H32ClN5OS/c1-3-19-8-7-9-20(21(19)25)29-14-12-28(13-15-29)11-6-4-5-10-26-23(31)22-18(2)30-16-17-32-24(30)27-22/h7-9,16-17H,3-6,10-15H2,1-2H3,(H,26,31) |
| InChIKey | JAKFCAJOXZJYMN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.07 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|