C17H19N7O2 — CID 165112254
2-[(1-ethylpyrazol-4-yl)amino]-4-[(4-hydroxyphenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 165112254) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)amino]-4-[(4-hydroxyphenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-[(4-hydroxyphenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 165112254 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-[(4-hydroxyphenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | CCn1cc(Nc2ncc(C(N)=O)c(NCc3ccc(O)cc3)n2)cn1 |
| InChI | InChI=1S/C17H19N7O2/c1-2-24-10-12(8-21-24)22-17-20-9-14(15(18)26)16(23-17)19-7-11-3-5-13(25)6-4-11/h3-6,8-10,25H,2,7H2,1H3,(H2,18,26)(H2,19,20,22,23) |
| InChIKey | RNOPZZDYXCYRRO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |