C29H37F2N5O2 — CID 165112403
N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methylindazol-4-yl)acetamide (PubChem CID 165112403) has the molecular formula C29H37F2N5O2 and a molecular weight of 525.64 g/mol. Its IUPAC name is N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methylindazol-4-yl)acetamide.
| Compound Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methylindazol-4-yl)acetamide |
|---|---|
| PubChem CID | 165112403 |
| Molecular Formula | C29H37F2N5O2 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | N-[4-[2-[2-(2,2-difluoroethoxy)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-7-yl]ethyl]cyclohexyl]-2-(2-methylindazol-4-yl)acetamide |
| SMILES | Cn1cc2c(CC(=O)NC3CCC(CCN4CCc5ccc(OCC(F)F)nc5CC4)CC3)cccc2n1 |
| InChI | InChI=1S/C29H37F2N5O2/c1-35-18-24-22(3-2-4-26(24)34-35)17-28(37)32-23-8-5-20(6-9-23)11-14-36-15-12-21-7-10-29(38-19-27(30)31)33-25(21)13-16-36/h2-4,7,10,18,20,23,27H,5-6,8-9,11-17,19H2,1H3,(H,32,37) |
| InChIKey | RRJQXEPYGACJSE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |