C16H22N6O3 — CID 165112545
2-[4-[4-[(6-pyrazolidin-3-yl-3-pyridinyl)oxy]butyl]triazol-1-yl]acetic acid (PubChem CID 165112545) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[4-[4-[(6-pyrazolidin-3-yl-3-pyridinyl)oxy]butyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[(6-pyrazolidin-3-yl-3-pyridinyl)oxy]butyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 165112545 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-[4-[4-[(6-pyrazolidin-3-yl-3-pyridinyl)oxy]butyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CCCCOc2ccc(C3CCNN3)nc2)nn1 |
| InChI | InChI=1S/C16H22N6O3/c23-16(24)11-22-10-12(19-21-22)3-1-2-8-25-13-4-5-14(17-9-13)15-6-7-18-20-15/h4-5,9-10,15,18,20H,1-3,6-8,11H2,(H,23,24) |
| InChIKey | NRZOFYTXKHJTMA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|