C18H18ClN5O — CID 165112831
N-[4-[(7-chloro-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrazin-2-amine (PubChem CID 165112831) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is N-[4-[(7-chloro-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrazin-2-amine.
| Compound Name | N-[4-[(7-chloro-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 165112831 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[4-[(7-chloro-1,6-naphthyridin-5-yl)oxy]cyclohexyl]pyrazin-2-amine |
| SMILES | Clc1cc2ncccc2c(OC2CCC(Nc3cnccn3)CC2)n1 |
| InChI | InChI=1S/C18H18ClN5O/c19-16-10-15-14(2-1-7-21-15)18(24-16)25-13-5-3-12(4-6-13)23-17-11-20-8-9-22-17/h1-2,7-13H,3-6H2,(H,22,23) |
| InChIKey | BVMYIZRZGPYPKR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|