C14H14F3N3O4 — CID 165113925
N-[6-nitro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]acetamide (PubChem CID 165113925) has the molecular formula C14H14F3N3O4 and a molecular weight of 345.28 g/mol. Its IUPAC name is N-[6-nitro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]acetamide.
| Compound Name | N-[6-nitro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]acetamide |
|---|---|
| PubChem CID | 165113925 |
| Molecular Formula | C14H14F3N3O4 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[6-nitro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1[N+](=O)[O-])CCN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C14H14F3N3O4/c1-8(21)18-11-3-2-9-4-6-19(13(22)14(15,16)17)7-5-10(9)12(11)20(23)24/h2-3H,4-7H2,1H3,(H,18,21) |
| InChIKey | KQOBUBMPCRTBDB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|