C16H18Cl2F2N2O4 — CID 165114118
cyclopentene;N'-(3,5-dichlorophenyl)-2,2-difluoropropanediamide;methyl formate (PubChem CID 165114118) has the molecular formula C16H18Cl2F2N2O4 and a molecular weight of 411.23 g/mol. Its IUPAC name is cyclopentene;N'-(3,5-dichlorophenyl)-2,2-difluoropropanediamide;methyl formate.
| Compound Name | cyclopentene;N'-(3,5-dichlorophenyl)-2,2-difluoropropanediamide;methyl formate |
|---|---|
| PubChem CID | 165114118 |
| Molecular Formula | C16H18Cl2F2N2O4 |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | cyclopentene;N'-(3,5-dichlorophenyl)-2,2-difluoropropanediamide;methyl formate |
| SMILES | C1=CCCC1.COC=O.NC(=O)C(F)(F)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2F2N2O2.C5H8.C2H4O2/c10-4-1-5(11)3-6(2-4)15-8(17)9(12,13)7(14)16;1-2-4-5-3-1;1-4-2-3/h1-3H,(H2,14,16)(H,15,17);1-2H,3-5H2;2H,1H3 |
| InChIKey | MNJIFEVGAYJQBV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|