C27H33FN6O3 — CID 165114446
1-[3-fluoro-4-[3-(12-methyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl)azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 165114446) has the molecular formula C27H33FN6O3 and a molecular weight of 508.60 g/mol. Its IUPAC name is 1-[3-fluoro-4-[3-(12-methyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl)azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-fluoro-4-[3-(12-methyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl)azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 165114446 |
| Molecular Formula | C27H33FN6O3 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 1-[3-fluoro-4-[3-(12-methyl-7-morpholin-4-yl-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl)azetidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(N2CC(c3cc4c(c(C)n3)OCc3c(N5CCOCC5)ccnc3N4)C2)C(F)C1 |
| InChI | InChI=1S/C27H33FN6O3/c1-3-25(35)33-7-5-24(20(28)15-33)34-13-18(14-34)21-12-22-26(17(2)30-21)37-16-19-23(4-6-29-27(19)31-22)32-8-10-36-11-9-32/h3-4,6,12,18,20,24H,1,5,7-11,13-16H2,2H3,(H,29,31) |
| InChIKey | GIMGFBGMIDFLBP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|