C29H31N5O5 — CID 165114815
tert-butyl 4-morpholin-4-yl-9-[6-(prop-2-enoylamino)-3-pyridinyl]-5H-pyrido[3,2-c][1,5]benzoxazepine-11-carboxylate (PubChem CID 165114815) has the molecular formula C29H31N5O5 and a molecular weight of 529.60 g/mol. Its IUPAC name is tert-butyl 4-morpholin-4-yl-9-[6-(prop-2-enoylamino)-3-pyridinyl]-5H-pyrido[3,2-c][1,5]benzoxazepine-11-carboxylate.
| Compound Name | tert-butyl 4-morpholin-4-yl-9-[6-(prop-2-enoylamino)-3-pyridinyl]-5H-pyrido[3,2-c][1,5]benzoxazepine-11-carboxylate |
|---|---|
| PubChem CID | 165114815 |
| Molecular Formula | C29H31N5O5 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | tert-butyl 4-morpholin-4-yl-9-[6-(prop-2-enoylamino)-3-pyridinyl]-5H-pyrido[3,2-c][1,5]benzoxazepine-11-carboxylate |
| SMILES | C=CC(=O)Nc1ccc(-c2ccc3c(c2)N(C(=O)OC(C)(C)C)c2nccc(N4CCOCC4)c2CO3)cn1 |
| InChI | InChI=1S/C29H31N5O5/c1-5-26(35)32-25-9-7-20(17-31-25)19-6-8-24-23(16-19)34(28(36)39-29(2,3)4)27-21(18-38-24)22(10-11-30-27)33-12-14-37-15-13-33/h5-11,16-17H,1,12-15,18H2,2-4H3,(H,31,32,35) |
| InChIKey | RSAYLYPJFZUHIT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|