C27H31F3N6O3 — CID 165115136
1-[3-[3-[(9S)-9-methyl-7-morpholin-4-yl-12-(trifluoromethyl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 165115136) has the molecular formula C27H31F3N6O3 and a molecular weight of 544.58 g/mol. Its IUPAC name is 1-[3-[3-[(9S)-9-methyl-7-morpholin-4-yl-12-(trifluoromethyl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-[(9S)-9-methyl-7-morpholin-4-yl-12-(trifluoromethyl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 165115136 |
| Molecular Formula | C27H31F3N6O3 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1-[3-[3-[(9S)-9-methyl-7-morpholin-4-yl-12-(trifluoromethyl)-10-oxa-2,4,13-triazatricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-14-yl]azetidin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(N2CC(c3cc4c(c(C(F)(F)F)n3)O[C@@H](C)c3c(N5CCOCC5)ccnc3N4)C2)C1 |
| InChI | InChI=1S/C27H31F3N6O3/c1-3-22(37)35-7-5-18(15-35)36-13-17(14-36)19-12-20-24(25(32-19)27(28,29)30)39-16(2)23-21(4-6-31-26(23)33-20)34-8-10-38-11-9-34/h3-4,6,12,16-18H,1,5,7-11,13-15H2,2H3,(H,31,33)/t16-,18?/m0/s1 |
| InChIKey | HEZKODMERSEMMP-ATNAJCNCSA-N |
| XLogP | 3.72 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|