C7H6INS4 — CID 165116329
[4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl] thiohypoiodite (PubChem CID 165116329) has the molecular formula C7H6INS4 and a molecular weight of 359.30 g/mol. Its IUPAC name is [4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl] thiohypoiodite.
| Compound Name | [4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl] thiohypoiodite |
|---|---|
| PubChem CID | 165116329 |
| Molecular Formula | C7H6INS4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.84 |
| IUPAC Name | [4,6-bis(sulfanylidene)-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl] thiohypoiodite |
| SMILES | S=C1C=C2SCCC2C(=S)N1SI |
| InChI | InChI=1S/C7H6INS4/c8-13-9-6(10)3-5-4(7(9)11)1-2-12-5/h3-4H,1-2H2 |
| InChIKey | LWSBFYJKCDHKNB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|