About 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione
3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione (PubChem CID 165116370) has the molecular formula C8H10INS3
and a molecular weight of 343.28 g/mol. Its IUPAC name is 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione.
Molecular Properties
| Compound Name | 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione |
| PubChem CID | 165116370 |
| Molecular Formula | C8H10INS3 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.90 |
| IUPAC Name | 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione |
| SMILES | CCC1C(=S)N(I)C(=S)C=C1SC |
| InChI | InChI=1S/C8H10INS3/c1-3-5-6(13-2)4-7(11)10(9)8(5)12/h4-5H,3H2,1-2H3 |
| InChIKey | QFABYROMBXRCMG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione?
The IUPAC name of 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione (CID 165116370) is 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione.
What is the SMILES notation for 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione?
The canonical SMILES for 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione is CCC1C(=S)N(I)C(=S)C=C1SC.
What is the InChIKey of 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione?
The InChIKey is QFABYROMBXRCMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10INS3/c1-3-5-6(13-2)4-7(11)10(9)8(5)12/h4-5H,3H2,1-2H3.
What are the key properties of 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione?
3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione has a molecular weight of 343.28 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-iodo-4-methylsulfanyl-3H-pyridine-2,6-dithione is sourced from PubChem (CID 165116370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).