C17H26IN4O3- — CID 165116622
1-[[1-[2-[4-(methylamino)butyliodanuidyl]ethyl]-2-oxo-3-pyridinyl]methyl]-1,3-diazinane-2,4-dione (PubChem CID 165116622) has the molecular formula C17H26IN4O3- and a molecular weight of 461.32 g/mol. Its IUPAC name is 1-[[1-[2-[4-(methylamino)butyliodanuidyl]ethyl]-2-oxo-3-pyridinyl]methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[[1-[2-[4-(methylamino)butyliodanuidyl]ethyl]-2-oxo-3-pyridinyl]methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 165116622 |
| Molecular Formula | C17H26IN4O3- |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-[[1-[2-[4-(methylamino)butyliodanuidyl]ethyl]-2-oxo-3-pyridinyl]methyl]-1,3-diazinane-2,4-dione |
| SMILES | CNCCCC[I-]CCn1cccc(CN2CCC(=O)NC2=O)c1=O |
| InChI | InChI=1S/C17H26IN4O3/c1-19-9-3-2-7-18-8-12-21-10-4-5-14(16(21)24)13-22-11-6-15(23)20-17(22)25/h4-5,10,19H,2-3,6-9,11-13H2,1H3,(H,20,23,25)/q-1 |
| InChIKey | GYPUXPNLCSKEEO-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|