C12H6N2O8 — CID 165116815
2,3,7,8-tetrahydroxy-5,10-dihydrophenazine-1,4,6,9-tetrone (PubChem CID 165116815) has the molecular formula C12H6N2O8 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2,3,7,8-tetrahydroxy-5,10-dihydrophenazine-1,4,6,9-tetrone.
| Compound Name | 2,3,7,8-tetrahydroxy-5,10-dihydrophenazine-1,4,6,9-tetrone |
|---|---|
| PubChem CID | 165116815 |
| Molecular Formula | C12H6N2O8 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2,3,7,8-tetrahydroxy-5,10-dihydrophenazine-1,4,6,9-tetrone |
| SMILES | O=c1c(O)c(O)c(=O)c2[nH]c3c(=O)c(O)c(O)c(=O)c3[nH]c12 |
| InChI | InChI=1S/C12H6N2O8/c15-5-1-2(6(16)10(20)9(5)19)14-4-3(13-1)7(17)11(21)12(22)8(4)18/h13-14,19-22H |
| InChIKey | RUZHYCZSCLGVAN-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 180.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|