About 4H-imidazo[4,5-b]pyridin-4-ium
4H-imidazo[4,5-b]pyridin-4-ium (PubChem CID 165117308) has the molecular formula C6H6N3+
and a molecular weight of 120.13 g/mol. Its IUPAC name is 4H-imidazo[4,5-b]pyridin-4-ium.
Molecular Properties
| Compound Name | 4H-imidazo[4,5-b]pyridin-4-ium |
| PubChem CID | 165117308 |
| Molecular Formula | C6H6N3+ |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 4H-imidazo[4,5-b]pyridin-4-ium |
| SMILES | C1=C[NH2+]C2=NC=NC2=C1 |
| InChI | InChI=1S/C6H5N3/c1-2-5-6(7-3-1)9-4-8-5/h1-4H,(H,7,8,9)/p+1 |
| InChIKey | GAMYYCRTACQSBR-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 41.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-imidazo[4,5-b]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-imidazo[4,5-b]pyridin-4-ium?
The IUPAC name of 4H-imidazo[4,5-b]pyridin-4-ium (CID 165117308) is 4H-imidazo[4,5-b]pyridin-4-ium.
What is the SMILES notation for 4H-imidazo[4,5-b]pyridin-4-ium?
The canonical SMILES for 4H-imidazo[4,5-b]pyridin-4-ium is C1=C[NH2+]C2=NC=NC2=C1.
What is the InChIKey of 4H-imidazo[4,5-b]pyridin-4-ium?
The InChIKey is GAMYYCRTACQSBR-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H5N3/c1-2-5-6(7-3-1)9-4-8-5/h1-4H,(H,7,8,9)/p+1.
What are the key properties of 4H-imidazo[4,5-b]pyridin-4-ium?
4H-imidazo[4,5-b]pyridin-4-ium has a molecular weight of 120.13 g/mol, XLogP of -0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-imidazo[4,5-b]pyridin-4-ium is sourced from PubChem (CID 165117308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).