About 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine
2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine (PubChem CID 165117617) has the molecular formula C10H12ClNO
and a molecular weight of 197.66 g/mol. Its IUPAC name is 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine.
Molecular Properties
| Compound Name | 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| PubChem CID | 165117617 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine |
| SMILES | CC1(C)Cc2nc(Cl)ccc2CO1 |
| InChI | InChI=1S/C10H12ClNO/c1-10(2)5-8-7(6-13-10)3-4-9(11)12-8/h3-4H,5-6H2,1-2H3 |
| InChIKey | KQALAFGXSSMIOD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
The IUPAC name of 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine (CID 165117617) is 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine.
What is the SMILES notation for 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
The canonical SMILES for 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine is CC1(C)Cc2nc(Cl)ccc2CO1.
What is the InChIKey of 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
The InChIKey is KQALAFGXSSMIOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO/c1-10(2)5-8-7(6-13-10)3-4-9(11)12-8/h3-4H,5-6H2,1-2H3.
What are the key properties of 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine?
2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine has a molecular weight of 197.66 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7,7-dimethyl-5,8-dihydropyrano[4,3-b]pyridine is sourced from PubChem (CID 165117617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).