C12H13F3N2 — CID 165118434
4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)aniline (PubChem CID 165118434) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 165118434 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-(1,2,3,6-tetrahydropyridin-4-yl)-2-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(C2=CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2/c13-12(14,15)10-7-9(1-2-11(10)16)8-3-5-17-6-4-8/h1-3,7,17H,4-6,16H2 |
| InChIKey | KXHPZNBHQJWWHL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|