About propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine
propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine (PubChem CID 165119278) has the molecular formula C19H32N2
and a molecular weight of 288.48 g/mol. Its IUPAC name is propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine.
Molecular Properties
| Compound Name | propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine |
| PubChem CID | 165119278 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine |
| SMILES | C/C=C/c1ccc(N2CCNCC2)cc1.C=CC.CCC |
| InChI | InChI=1S/C13H18N2.C3H8.C3H6/c1-2-3-12-4-6-13(7-5-12)15-10-8-14-9-11-15;2*1-3-2/h2-7,14H,8-11H2,1H3;3H2,1-2H3;3H,1H2,2H3/b3-2+;; |
| InChIKey | JLFKWYCTEUWCIG-WTVBWJGASA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine?
The IUPAC name of propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine (CID 165119278) is propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine.
What is the SMILES notation for propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine?
The canonical SMILES for propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine is C/C=C/c1ccc(N2CCNCC2)cc1.C=CC.CCC.
What is the InChIKey of propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine?
The InChIKey is JLFKWYCTEUWCIG-WTVBWJGASA-N. The full InChI is InChI=1S/C13H18N2.C3H8.C3H6/c1-2-3-12-4-6-13(7-5-12)15-10-8-14-9-11-15;2*1-3-2/h2-7,14H,8-11H2,1H3;3H2,1-2H3;3H,1H2,2H3/b3-2+;;.
What are the key properties of propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine?
propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine has a molecular weight of 288.48 g/mol, XLogP of 4.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;prop-1-ene;1-[4-[(E)-prop-1-enyl]phenyl]piperazine is sourced from PubChem (CID 165119278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).