C20H28ClFN4O3 — CID 165119771
(3R)-3-[(4-chloro-5-ethyl-2-fluorophenyl)methylcarbamoyl-cyclopropylamino]-N-methoxypiperidine-1-carboxamide (PubChem CID 165119771) has the molecular formula C20H28ClFN4O3 and a molecular weight of 426.92 g/mol. Its IUPAC name is (3R)-3-[(4-chloro-5-ethyl-2-fluorophenyl)methylcarbamoyl-cyclopropylamino]-N-methoxypiperidine-1-carboxamide.
| Compound Name | (3R)-3-[(4-chloro-5-ethyl-2-fluorophenyl)methylcarbamoyl-cyclopropylamino]-N-methoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 165119771 |
| Molecular Formula | C20H28ClFN4O3 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | (3R)-3-[(4-chloro-5-ethyl-2-fluorophenyl)methylcarbamoyl-cyclopropylamino]-N-methoxypiperidine-1-carboxamide |
| SMILES | CCc1cc(CNC(=O)N(C2CC2)[C@@H]2CCCN(C(=O)NOC)C2)c(F)cc1Cl |
| InChI | InChI=1S/C20H28ClFN4O3/c1-3-13-9-14(18(22)10-17(13)21)11-23-19(27)26(15-6-7-15)16-5-4-8-25(12-16)20(28)24-29-2/h9-10,15-16H,3-8,11-12H2,1-2H3,(H,23,27)(H,24,28)/t16-/m1/s1 |
| InChIKey | FRSXINQEZLZZPO-MRXNPFEDSA-N |
| XLogP | 3.45 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|