C19H24ClN5O — CID 165119866
3-[2-(3-chlorophenyl)ethyl]-1-methyl-1-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]urea (PubChem CID 165119866) has the molecular formula C19H24ClN5O and a molecular weight of 373.89 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethyl]-1-methyl-1-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]urea.
| Compound Name | 3-[2-(3-chlorophenyl)ethyl]-1-methyl-1-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]urea |
|---|---|
| PubChem CID | 165119866 |
| Molecular Formula | C19H24ClN5O |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethyl]-1-methyl-1-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]urea |
| SMILES | CN(C(=O)NCCc1cccc(Cl)c1)[C@@H]1CCCN(c2cccnn2)C1 |
| InChI | InChI=1S/C19H24ClN5O/c1-24(19(26)21-11-9-15-5-2-6-16(20)13-15)17-7-4-12-25(14-17)18-8-3-10-22-23-18/h2-3,5-6,8,10,13,17H,4,7,9,11-12,14H2,1H3,(H,21,26)/t17-/m1/s1 |
| InChIKey | GRCOLBDADTWUGI-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |