C26H23FIN7OSi- — CID 165120534
CID 165120534 (PubChem CID 165120534) has the molecular formula C26H23FIN7OSi- and a molecular weight of 623.51 g/mol.
| Compound Name | CID 165120534 |
|---|---|
| PubChem CID | 165120534 |
| Molecular Formula | C26H23FIN7OSi- |
| Molecular Weight | 623.51 g/mol |
| Exact Mass | 623.08 |
| IUPAC Name | — |
| SMILES | CN1CC[I-][C@@]([Si])(Oc2cc(-c3cnn(C)c3)cc3ncnc(Nc4ccc5ncccc5c4F)c23)C1 |
| InChI | InChI=1S/C26H23FIN7OSi/c1-34-9-7-28-26(37,14-34)36-22-11-16(17-12-32-35(2)13-17)10-21-23(22)25(31-15-30-21)33-20-6-5-19-18(24(20)27)4-3-8-29-19/h3-6,8,10-13,15H,7,9,14H2,1-2H3,(H,30,31,33)/q-1/t26-/m1/s1 |
| InChIKey | GAIPVTJBKNIRJP-AREMUKBSSA-N |
| XLogP | 0.70 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.51 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|