C22H41N5O2 — CID 165120886
N'-[[3-[4,4-bis(methoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]methyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 165120886) has the molecular formula C22H41N5O2 and a molecular weight of 407.60 g/mol. Its IUPAC name is N'-[[3-[4,4-bis(methoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]methyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[[3-[4,4-bis(methoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]methyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 165120886 |
| Molecular Formula | C22H41N5O2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.33 |
| IUPAC Name | N'-[[3-[4,4-bis(methoxymethyl)cyclohexyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-2-yl]methyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | COCC1(COC)CCC(c2c(CN(C)CCN(C)C)nn3c2CNCC3)CC1 |
| InChI | InChI=1S/C22H41N5O2/c1-25(2)12-13-26(3)15-19-21(20-14-23-10-11-27(20)24-19)18-6-8-22(9-7-18,16-28-4)17-29-5/h18,23H,6-17H2,1-5H3 |
| InChIKey | XJTCXPQCUQGTKI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |