C31H40N6O4 — CID 165121565
(2R)-2-[1-[(3S)-oxolan-3-yl]indazol-7-yl]-3-[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]propanoic acid (PubChem CID 165121565) has the molecular formula C31H40N6O4 and a molecular weight of 560.70 g/mol. Its IUPAC name is (2R)-2-[1-[(3S)-oxolan-3-yl]indazol-7-yl]-3-[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]propanoic acid.
| Compound Name | (2R)-2-[1-[(3S)-oxolan-3-yl]indazol-7-yl]-3-[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165121565 |
| Molecular Formula | C31H40N6O4 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | (2R)-2-[1-[(3S)-oxolan-3-yl]indazol-7-yl]-3-[[(3R)-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]piperidine-3-carbonyl]amino]propanoic acid |
| SMILES | O=C(NC[C@H](C(=O)O)c1cccc2cnn([C@H]3CCOC3)c12)[C@@H]1CCCN(CCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C31H40N6O4/c38-30(23-7-3-14-36(19-23)15-4-8-24-11-10-21-6-2-13-32-29(21)35-24)33-18-27(31(39)40)26-9-1-5-22-17-34-37(28(22)26)25-12-16-41-20-25/h1,5,9-11,17,23,25,27H,2-4,6-8,12-16,18-20H2,(H,32,35)(H,33,38)(H,39,40)/t23-,25+,27+/m1/s1 |
| InChIKey | GLRXWIOULBLLKQ-NIYJGHKDSA-N |
| XLogP | 3.38 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |