C28H33CsN2O4S — CID 165122230
cesium;tert-butyl N-[1-(4-benzylsulfanyl-3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate;carbanide (PubChem CID 165122230) has the molecular formula C28H33CsN2O4S and a molecular weight of 626.55 g/mol. Its IUPAC name is cesium;tert-butyl N-[1-(4-benzylsulfanyl-3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate;carbanide.
| Compound Name | cesium;tert-butyl N-[1-(4-benzylsulfanyl-3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate;carbanide |
|---|---|
| PubChem CID | 165122230 |
| Molecular Formula | C28H33CsN2O4S |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 626.12 |
| IUPAC Name | cesium;tert-butyl N-[1-(4-benzylsulfanyl-3-hydroxyanilino)-1-oxo-3-phenylpropan-2-yl]carbamate;carbanide |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)Nc1ccc(SCc2ccccc2)c(O)c1.[CH3-].[Cs+] |
| InChI | InChI=1S/C27H30N2O4S.CH3.Cs/c1-27(2,3)33-26(32)29-22(16-19-10-6-4-7-11-19)25(31)28-21-14-15-24(23(30)17-21)34-18-20-12-8-5-9-13-20;;/h4-15,17,22,30H,16,18H2,1-3H3,(H,28,31)(H,29,32);1H3;/q;-1;+1 |
| InChIKey | DVHUYNHSGPEETF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|