C23H28FN5O3S — CID 165122267
4-fluoro-N-[1-[[6-(oxetan-3-ylamino)sulfanyl-3-pyridinyl]amino]-1-oxo-3-piperidin-4-ylpropan-2-yl]benzamide (PubChem CID 165122267) has the molecular formula C23H28FN5O3S and a molecular weight of 473.57 g/mol. Its IUPAC name is 4-fluoro-N-[1-[[6-(oxetan-3-ylamino)sulfanyl-3-pyridinyl]amino]-1-oxo-3-piperidin-4-ylpropan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[1-[[6-(oxetan-3-ylamino)sulfanyl-3-pyridinyl]amino]-1-oxo-3-piperidin-4-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 165122267 |
| Molecular Formula | C23H28FN5O3S |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-fluoro-N-[1-[[6-(oxetan-3-ylamino)sulfanyl-3-pyridinyl]amino]-1-oxo-3-piperidin-4-ylpropan-2-yl]benzamide |
| SMILES | O=C(NC(CC1CCNCC1)C(=O)Nc1ccc(SNC2COC2)nc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FN5O3S/c24-17-3-1-16(2-4-17)22(30)28-20(11-15-7-9-25-10-8-15)23(31)27-18-5-6-21(26-12-18)33-29-19-13-32-14-19/h1-6,12,15,19-20,25,29H,7-11,13-14H2,(H,27,31)(H,28,30) |
| InChIKey | SIFCKDPGBFSHTI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|