N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen

C10H23N — CID 165122655

IUPACN-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen
SMILESCC(C)NCCC1CCCC1.[H][H]
InChIInChI=1S/C10H21N.H2/c1-9(2)11-8-7-10-5-3-4-6-10;/h9-11H,3-8H2,1-2H3;1H
InChIKeyPWVFWSUSRSETNL-UHFFFAOYSA-N
MW157.30 g/mol
LogP2.81
Rot. Bonds4

About N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen

N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen (PubChem CID 165122655) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen.

Molecular Properties

Compound NameN-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen
PubChem CID165122655
Molecular FormulaC10H23N
Molecular Weight157.30 g/mol
Exact Mass157.18
IUPAC NameN-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen
SMILESCC(C)NCCC1CCCC1.[H][H]
InChIInChI=1S/C10H21N.H2/c1-9(2)11-8-7-10-5-3-4-6-10;/h9-11H,3-8H2,1-2H3;1H
InChIKeyPWVFWSUSRSETNL-UHFFFAOYSA-N
XLogP2.81
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.30
LogP ≤ 52.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
The IUPAC name of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen (CID 165122655) is N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen.
What is the SMILES notation for N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
The canonical SMILES for N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen is CC(C)NCCC1CCCC1.[H][H].
What is the InChIKey of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
The InChIKey is PWVFWSUSRSETNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.H2/c1-9(2)11-8-7-10-5-3-4-6-10;/h9-11H,3-8H2,1-2H3;1H.
What are the key properties of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen has a molecular weight of 157.30 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen is sourced from PubChem (CID 165122655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).