About N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen
N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen (PubChem CID 165122655) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen |
| PubChem CID | 165122655 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen |
| SMILES | CC(C)NCCC1CCCC1.[H][H] |
| InChI | InChI=1S/C10H21N.H2/c1-9(2)11-8-7-10-5-3-4-6-10;/h9-11H,3-8H2,1-2H3;1H |
| InChIKey | PWVFWSUSRSETNL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
The IUPAC name of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen (CID 165122655) is N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen.
What is the SMILES notation for N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
The canonical SMILES for N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen is CC(C)NCCC1CCCC1.[H][H].
What is the InChIKey of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
The InChIKey is PWVFWSUSRSETNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.H2/c1-9(2)11-8-7-10-5-3-4-6-10;/h9-11H,3-8H2,1-2H3;1H.
What are the key properties of N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen?
N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen has a molecular weight of 157.30 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclopentylethyl)propan-2-amine;molecular hydrogen is sourced from PubChem (CID 165122655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).