C16H14FN3O6S2 — CID 165122718
5-[2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-8-fluoro-6-hydroxyquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 165122718) has the molecular formula C16H14FN3O6S2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 5-[2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-8-fluoro-6-hydroxyquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-8-fluoro-6-hydroxyquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 165122718 |
| Molecular Formula | C16H14FN3O6S2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 5-[2-(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl)-8-fluoro-6-hydroxyquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3ccc(C4=CCS(=O)(=O)CC4)nc3c2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H14FN3O6S2/c17-14-15-10(1-2-11(18-15)9-3-5-27(23,24)6-4-9)7-12(21)16(14)20-8-13(22)19-28(20,25)26/h1-3,7,21H,4-6,8H2,(H,19,22) |
| InChIKey | IADWCCNJXGMIMW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |