About 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine
3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine (PubChem CID 165122743) has the molecular formula C21H28N4O
and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine |
| PubChem CID | 165122743 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine |
| SMILES | C=C1COc2ccccc2N1.CC(C)(C)c1[nH]nc2ccccc12.CN |
| InChI | InChI=1S/C11H14N2.C9H9NO.CH5N/c1-11(2,3)10-8-6-4-5-7-9(8)12-13-10;1-7-6-11-9-5-3-2-4-8(9)10-7;1-2/h4-7H,1-3H3,(H,12,13);2-5,10H,1,6H2;2H2,1H3 |
| InChIKey | FIFGZLYRXGUQNP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine?
The IUPAC name of 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine (CID 165122743) is 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine.
What is the SMILES notation for 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine?
The canonical SMILES for 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine is C=C1COc2ccccc2N1.CC(C)(C)c1[nH]nc2ccccc12.CN.
What is the InChIKey of 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine?
The InChIKey is FIFGZLYRXGUQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.C9H9NO.CH5N/c1-11(2,3)10-8-6-4-5-7-9(8)12-13-10;1-7-6-11-9-5-3-2-4-8(9)10-7;1-2/h4-7H,1-3H3,(H,12,13);2-5,10H,1,6H2;2H2,1H3.
What are the key properties of 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine?
3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine has a molecular weight of 352.48 g/mol, XLogP of 4.44, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-2H-indazole;methanamine;3-methylidene-4H-1,4-benzoxazine is sourced from PubChem (CID 165122743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).