About ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole
ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole (PubChem CID 165122887) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole.
Molecular Properties
| Compound Name | ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole |
| PubChem CID | 165122887 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole |
| SMILES | CC.Cn1cnc2c1=CC1CC1C=2 |
| InChI | InChI=1S/C9H10N2.C2H6/c1-11-5-10-8-3-6-2-7(6)4-9(8)11;1-2/h3-7H,2H2,1H3;1-2H3 |
| InChIKey | DQXYXDNKIZNYAR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The IUPAC name of ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole (CID 165122887) is ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole.
What is the SMILES notation for ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The canonical SMILES for ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole is CC.Cn1cnc2c1=CC1CC1C=2.
What is the InChIKey of ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
The InChIKey is DQXYXDNKIZNYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C2H6/c1-11-5-10-8-3-6-2-7(6)4-9(8)11;1-2/h3-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole?
ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole has a molecular weight of 176.26 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-5,5a-dihydro-4aH-cyclopropa[f]benzimidazole is sourced from PubChem (CID 165122887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).