C32H34F3N7O — CID 165123678
1-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-8-fluoroisoquinolin-3-amine (PubChem CID 165123678) has the molecular formula C32H34F3N7O and a molecular weight of 589.67 g/mol. Its IUPAC name is 1-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-8-fluoroisoquinolin-3-amine.
| Compound Name | 1-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-8-fluoroisoquinolin-3-amine |
|---|---|
| PubChem CID | 165123678 |
| Molecular Formula | C32H34F3N7O |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 1-[4-[(1S,6R)-3,9-diazabicyclo[4.2.1]nonan-3-yl]-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-7-yl]-8-fluoroisoquinolin-3-amine |
| SMILES | Nc1cc2cccc(F)c2c(-c2ccc3c(N4CC[C@H]5CC[C@@H](C4)N5)nc(OC[C@@]45CCCN4C[C@H](F)C5)nc3c2F)n1 |
| InChI | InChI=1S/C32H34F3N7O/c33-19-14-32(10-2-11-42(32)15-19)17-43-31-39-29-23(30(40-31)41-12-9-20-5-6-21(16-41)37-20)8-7-22(27(29)35)28-26-18(13-25(36)38-28)3-1-4-24(26)34/h1,3-4,7-8,13,19-21,37H,2,5-6,9-12,14-17H2,(H2,36,38)/t19-,20-,21+,32+/m1/s1 |
| InChIKey | NVALHJZSEYDXPC-OXJZSGHZSA-N |
| XLogP | 4.99 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |