About 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane
3,3-diethyl-1,2-dimethylpiperidine;ethane;propane (PubChem CID 165123719) has the molecular formula C16H37N
and a molecular weight of 243.48 g/mol. Its IUPAC name is 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane.
Molecular Properties
| Compound Name | 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane |
| PubChem CID | 165123719 |
| Molecular Formula | C16H37N |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 243.29 |
| IUPAC Name | 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane |
| SMILES | CC.CCC.CCC1(CC)CCCN(C)C1C |
| InChI | InChI=1S/C11H23N.C3H8.C2H6/c1-5-11(6-2)8-7-9-12(4)10(11)3;1-3-2;1-2/h10H,5-9H2,1-4H3;3H2,1-2H3;1-2H3 |
| InChIKey | FKOLFLAWOCNOBK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane?
The IUPAC name of 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane (CID 165123719) is 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane.
What is the SMILES notation for 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane?
The canonical SMILES for 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane is CC.CCC.CCC1(CC)CCCN(C)C1C.
What is the InChIKey of 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane?
The InChIKey is FKOLFLAWOCNOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.C3H8.C2H6/c1-5-11(6-2)8-7-9-12(4)10(11)3;1-3-2;1-2/h10H,5-9H2,1-4H3;3H2,1-2H3;1-2H3.
What are the key properties of 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane?
3,3-diethyl-1,2-dimethylpiperidine;ethane;propane has a molecular weight of 243.48 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-1,2-dimethylpiperidine;ethane;propane is sourced from PubChem (CID 165123719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).