C12H13F3N2O2 — CID 165124091
7-[(2R)-2-(2,2,2-trifluoroethylamino)propyl]-3H-1,3-benzoxazol-2-one (PubChem CID 165124091) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 7-[(2R)-2-(2,2,2-trifluoroethylamino)propyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[(2R)-2-(2,2,2-trifluoroethylamino)propyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 165124091 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 7-[(2R)-2-(2,2,2-trifluoroethylamino)propyl]-3H-1,3-benzoxazol-2-one |
| SMILES | C[C@H](Cc1cccc2[nH]c(=O)oc12)NCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O2/c1-7(16-6-12(13,14)15)5-8-3-2-4-9-10(8)19-11(18)17-9/h2-4,7,16H,5-6H2,1H3,(H,17,18)/t7-/m1/s1 |
| InChIKey | KPJBMJFCALGAJG-SSDOTTSWSA-N |
| XLogP | 2.20 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |