C22H24FN7O — CID 165124193
[(4aR,7aR)-6-(4,6-dimethylpyrimidin-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-[5-fluoro-2-(triazol-2-yl)phenyl]methanone (PubChem CID 165124193) has the molecular formula C22H24FN7O and a molecular weight of 421.48 g/mol. Its IUPAC name is [(4aR,7aR)-6-(4,6-dimethylpyrimidin-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-[5-fluoro-2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [(4aR,7aR)-6-(4,6-dimethylpyrimidin-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-[5-fluoro-2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 165124193 |
| Molecular Formula | C22H24FN7O |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [(4aR,7aR)-6-(4,6-dimethylpyrimidin-2-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-[5-fluoro-2-(triazol-2-yl)phenyl]methanone |
| SMILES | Cc1cc(C)nc(N2C[C@H]3CCCN(C(=O)c4cc(F)ccc4-n4nccn4)[C@H]3C2)n1 |
| InChI | InChI=1S/C22H24FN7O/c1-14-10-15(2)27-22(26-14)28-12-16-4-3-9-29(20(16)13-28)21(31)18-11-17(23)5-6-19(18)30-24-7-8-25-30/h5-8,10-11,16,20H,3-4,9,12-13H2,1-2H3/t16-,20+/m1/s1 |
| InChIKey | QTIDLDMBYNETIM-UZLBHIALSA-N |
| XLogP | 2.55 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |